ChemNet > CAS > 1723-27-9 thieno[3,2-b]thiophene-2-carboxylic acid
1723-27-9 thieno[3,2-b]thiophene-2-carboxylic acid
نام محصول |
thieno[3,2-b]thiophene-2-carboxylic acid |
میدان مغناطیسی |
C7H4O2S2 |
وزن مولکولی |
184.2355 |
InChI |
InChI=1/C7H4O2S2/c8-7(9)6-3-5-4(11-6)1-2-10-5/h1-3H,(H,8,9) |
شماره سیایاس |
1723-27-9 |
ساختار مولکولی |
|
تراکم |
1.601g/cm3 |
نقطه ذوب |
218℃ |
نقطه غلیان |
386.7°C at 760 mmHg |
ضریب شکست |
1.769 |
نقطه اشتعال |
187.6°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|